cas: 478183-67-4 — see every product listed under this CAS number, including other names
Fmoc-D-Phe(3-I)-OH, 95%, 95% (CAS 478183-67-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DCFS-100mg |
| cas | 478183-67-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 222.80 Pln | |
| Chemat | 5g | 861.20 Pln | |
| Chemat | 10g | 1658.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid (CAS 478183-67-4) is a chemical compound with the molecular formula C24H20INO4 and a molecular weight of 513.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid. InChIKey: SSKOJXLIQFVOGC-JOCHJYFZSA-N.
| Molecular formula | C24H20INO4 |
|---|---|
| Molecular weight | 513.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid |
| InChIKey | SSKOJXLIQFVOGC-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)I)C(=O)O |
Computed by PubChem (NCBI)