cas: 478183-67-4 — see every product listed under this CAS number, including other names
FMOC-D-3-IODOPHENYLALANINE, 95% (CAS 478183-67-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F863560-5G |
| cas | 478183-67-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2351.27 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid (CAS 478183-67-4) is a chemical compound with the molecular formula C24H20INO4 and a molecular weight of 513.3 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid. InChIKey: SSKOJXLIQFVOGC-JOCHJYFZSA-N.
| Molecular formula | C24H20INO4 |
|---|---|
| Molecular weight | 513.3 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-iodophenyl)propanoic acid |
| InChIKey | SSKOJXLIQFVOGC-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)I)C(=O)O |
Computed by PubChem (NCBI)