cas: 220497-98-3 — see every product listed under this CAS number, including other names
Fmoc-D-Pra-OH, 99.75% (CAS 220497-98-3) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008395-25 g |
| cas | 220497-98-3 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 2228.38 Pln | |
| MedChemExpress | 5 g | 621.55 Pln | |
| MedChemExpress | 10 g | 1123.10 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.75% |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid (CAS 220497-98-3) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: DJGMNCKHNMRKFM-GOSISDBHSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | DJGMNCKHNMRKFM-GOSISDBHSA-N |
| SMILES | C#CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)