cas: 220497-98-3 — see every product listed under this CAS number, including other names
Fmoc-D-propraglycine, 97% (CAS 220497-98-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493076-1G |
| cas | 220497-98-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 732.05 Pln | |
| Fluorochem | 25g | 1664.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid (CAS 220497-98-3) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid. InChIKey: DJGMNCKHNMRKFM-GOSISDBHSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
| InChIKey | DJGMNCKHNMRKFM-GOSISDBHSA-N |
| SMILES | C#CC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)