cas: 101555-62-8 — see every product listed under this CAS number, including other names
Fmoc-D-Pro-OH, 98%, 98% (CAS 101555-62-8) is a chemical reagent available from Chemat. Available pack sizes: 250g, 1kg, 1g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115RL-250g |
| cas | 101555-62-8 |
| size | 250g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 419.60 Pln | |
| Chemat | 1kg | 1581.20 Pln | |
| Chemat | 1g | 69.20 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 213.20 Pln | |
| Chemat | 500g | 840.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 101555-62-8) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: ZPGDWQNBZYOZTI-GOSISDBHSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | ZPGDWQNBZYOZTI-GOSISDBHSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)