cas: 101555-62-8 — see every product listed under this CAS number, including other names
Fmoc-D-Pro-OH, 95% (CAS 101555-62-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03373-1G |
| cas | 101555-62-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 10g | 96.86 Pln | |
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 25g | 112.48 Pln | |
| Fluorochem | 50g | 169.75 Pln | |
| Fluorochem | 100g | 221.81 Pln | |
| Fluorochem | 500g | 862.21 Pln | |
| Fluorochem | 1kg | 1653.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 101555-62-8) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: ZPGDWQNBZYOZTI-GOSISDBHSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (2R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | ZPGDWQNBZYOZTI-GOSISDBHSA-N |
| SMILES | C1C[C@@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)