cas: 128107-47-1 — see every product listed under this CAS number, including other names
Fmoc-D-Ser(tBu)-OH, 99% (CAS 128107-47-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111XT5-250mg |
| cas | 128107-47-1 |
| size | 250mg |
| availability | 730g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 50g | 251.60 Pln | |
| Chemat | 100g | 438.80 Pln | |
| Chemat | 250g | 957.20 Pln | |
| Chemat | 500g | 1852.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 128107-47-1) is a chemical compound with the molecular formula C22H25NO5 and a molecular weight of 383.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: REITVGIIZHFVGU-LJQANCHMSA-N.
| Molecular formula | C22H25NO5 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | REITVGIIZHFVGU-LJQANCHMSA-N |
| SMILES | CC(C)(C)OC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)