cas: 153815-59-9 — see every product listed under this CAS number, including other names
Fmoc-Glu(OtBu)-ol 95% (CAS 153815-59-9) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241105-100g |
| cas | 153815-59-9 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 11634.44 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 242.44 Pln | |
| Ambeed | 5g | 926.62 Pln | |
| Ambeed | 10g | 1616.38 Pln | |
| Ambeed | 25g | 3602.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A241105 |
Tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoate (CAS 153815-59-9) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoate. InChIKey: XYRSVJWUWKIUAA-INIZCTEOSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoate |
| InChIKey | XYRSVJWUWKIUAA-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)