Products 761373-05-1
CAS 761373-05-1 appears in our catalog under these names: 2R,4S–Sacubitril, (2R,4S)-5-(Biphenyl-4-yl)-4-[(3-carboxypropionyl)amino]-2-methylpentanoic acid ethyl ester, 95%, Sacubitril Enantiomer, (2S,4R)-Sacubitril, >95% (HPLC), (2S,4R)-SACUBITRIL. Offered by: GLPBio, Combi-blocks, Chemat Brand, TRC, Sigma-Aldrich. Available pack sizes: 1mg, 1g, 250mg, on request, 10mg, 25mg, 5mg, 10mM (in 1ml dmso).
4-[[(2R,4S)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid (CAS 761373-05-1) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: 4-[[(2R,4S)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid. InChIKey: PYNXFZCZUAOOQC-LAUBAEHRSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 4-[[(2R,4S)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | PYNXFZCZUAOOQC-LAUBAEHRSA-N |
| SMILES | CCOC(=O)[C@@H](C)C[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)