cas: 153815-59-9 — see every product listed under this CAS number, including other names
Pentanoic acid, 4-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-5-hydroxy-, 1,1-dimethylethyl ester, (S)-, 97%, 97% (CAS 153815-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APPF-250mg |
| cas | 153815-59-9 |
| size | 250mg |
| availability | 150g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 712.40 Pln | |
| Chemat | 25g | 2526.80 Pln | |
| Chemat | 100mg | 88.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoate (CAS 153815-59-9) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoate. InChIKey: XYRSVJWUWKIUAA-INIZCTEOSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | tert-butyl (4S)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoate |
| InChIKey | XYRSVJWUWKIUAA-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](CO)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)