CAS 766480-48-2 appears in our catalog under these names: Sacubitril Impurity 2, 4-((rel-(2R,4R)-1-([1,1'-Biphenyl]-4-yl)-5-ethoxy-4-methyl-5-oxopentan-2-yl)amino)-4-oxobutanoic acid, 98%, (2R,4R)-Sacubitril, >95% (HPLC), 2R,4R–Sacubitril, (2R,4R)-Sacubitril. Offered by: Hubei YoungXin, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 1mg, 5mg.
4-[[(2R,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid (CAS 766480-48-2) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: 4-[[(2R,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid. InChIKey: PYNXFZCZUAOOQC-DYESRHJHSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | 4-[[(2R,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | PYNXFZCZUAOOQC-DYESRHJHSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)