Products 2382539-60-6
CAS 2382539-60-6 is the registry number for (3S,4S)-4-tert-Butoxy-3-(fmoc-amino)pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 5g, 1g, 250mg.
(3S,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid (CAS 2382539-60-6) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: (3S,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid. InChIKey: UFJMOCVIPRJMLW-BTYIYWSLSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (3S,4S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[(2-methylpropan-2-yl)oxy]pentanoic acid |
| InChIKey | UFJMOCVIPRJMLW-BTYIYWSLSA-N |
| SMILES | C[C@@H]([C@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)OC(C)(C)C |
Computed by PubChem (NCBI)