cas: 35665-38-4 — see every product listed under this CAS number, including other names
Fmoc-Gly-Gly-OH 98% (CAS 35665-38-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A432163-5g |
| cas | 35665-38-4 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 281.38 Pln | |
| Ambeed | 500g | 954.44 Pln | |
| Ambeed | 1000g | 1727.62 Pln | |
| Ambeed | 10g | 197.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A432163 |
2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetic acid (CAS 35665-38-4) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetic acid. InChIKey: FBKUOPULLUJMOC-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetic acid |
| InChIKey | FBKUOPULLUJMOC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)NCC(=O)O |
Computed by PubChem (NCBI)