CAS 1253909-21-5 appears in our catalog under these names: Spiropyran 1, 1',3',3'-Trimethyl-6-nitro-1',3'-dihydrospiro(chromene-2,2'-indole)-5',8-diol, 1',3',3'-Trimethyl-6-nitrospiro[chromene-2,2'-indoline]-5',8-diol 95%. Offered by: Chemat Brand, Biosynth, Ambeed. Available pack sizes: on request, 250mg, 100mg, 1g.
1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-5',8-diol (CAS 1253909-21-5) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-5',8-diol. InChIKey: ONHONFAZAXKJQE-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-5',8-diol |
| InChIKey | ONHONFAZAXKJQE-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)O)N(C13C=CC4=C(O3)C(=CC(=C4)[N+](=O)[O-])O)C)C |
Computed by PubChem (NCBI)