CAS 879759-57-6 is the registry number for Methyl 4-{(3-(2-hydroxy-4-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl)oxy}benzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-[[3-(2-hydroxy-4-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl]oxy]benzoate (CAS 879759-57-6) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: methyl 4-[[3-(2-hydroxy-4-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl]oxy]benzoate. InChIKey: DQZQSMAQQCQZTB-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | methyl 4-[[3-(2-hydroxy-4-methoxyphenyl)-5-methyl-1H-pyrazol-4-yl]oxy]benzoate |
| InChIKey | DQZQSMAQQCQZTB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C2=C(C=C(C=C2)OC)O)OC3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)