Products 475393-03-4
CAS 475393-03-4 is the registry number for N-(aza(3-oxoindanylidene)methyl)(3,4,5-trimethoxyphenyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
3,4,5-trimethoxy-N-[(Z)-(3-oxoinden-1-ylidene)amino]benzamide (CAS 475393-03-4) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: 3,4,5-trimethoxy-N-[(Z)-(3-oxoinden-1-ylidene)amino]benzamide. InChIKey: JSUWFNKRJPQBJI-ZHZULCJRSA-N.
| Molecular formula | C19H18N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 3,4,5-trimethoxy-N-[(Z)-(3-oxoinden-1-ylidene)amino]benzamide |
| InChIKey | JSUWFNKRJPQBJI-ZHZULCJRSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)N/N=C\2/CC(=O)C3=CC=CC=C23 |
Computed by PubChem (NCBI)