CAS 942047-38-3 is the registry number for 2-((Carbamoylmethyl)({((9H-fluoren-9-yl)methoxy)carbonyl})amino)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(2-amino-2-oxoethyl)-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 942047-38-3) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: 2-[(2-amino-2-oxoethyl)-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: OYVTXLYBPYCFPU-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 2-[(2-amino-2-oxoethyl)-(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| InChIKey | OYVTXLYBPYCFPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CC(=O)N)CC(=O)O |
Computed by PubChem (NCBI)