CAS 200335-41-7 appears in our catalog under these names: Fmoc-D-Asp-NH2, 95%, Fmoc-D-Asp-NH2, Fmoc-D-aspartic acid alpha-amide, 97%, 97%, Fmoc-D-IsoAsn-OH, 97%. Offered by: Combi-blocks, Iris Biotech, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 25g, 100mg, 10g.
(3R)-4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 200335-41-7) is a chemical compound with the molecular formula C19H18N2O5 and a molecular weight of 354.4 g/mol. IUPAC name: (3R)-4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: VHRMWRHTRSQVJJ-MRXNPFEDSA-N.
| Molecular formula | C19H18N2O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (3R)-4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | VHRMWRHTRSQVJJ-MRXNPFEDSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC(=O)O)C(=O)N |
Computed by PubChem (NCBI)