Fmoc-L-β-HoPhe-OH, 96%, 96%
cas: 193954-28-8 — see every product listed under this CAS number, including other names
Fmoc-L-β-HoPhe-OH, 96%, 96% (CAS 193954-28-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145YC-100mg |
| cas | 193954-28-8 |
| size | 100mg |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 1086.80 Pln | |
| Chemat | 25g | 2186.00 Pln | |
| Chemat | 100g | 7072.40 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid (CAS 193954-28-8) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid. InChIKey: DQNUGHJJKNFCND-SFHVURJKSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid |
| InChIKey | DQNUGHJJKNFCND-SFHVURJKSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-4-phenylbutanoic acid, (3S)-3-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-phenylbutanoic acid, Fmoc-L-beta-homophenylalanine, Fmoc-B-HoPhe-OH, (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-phenylbutanoic acid, (S)-3-(Fmoc-amino)-4-phenylbutanoic acid, Fmoc-L-beta-HoPhe-OH, (S)-3-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]-4-phenylbutanoic acid, (S)-3-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-4-phenylbutanoic acid, Fmoc-|A-HoPhe-OH