CAS 374791-01-2 appears in our catalog under these names: Fmoc–(S)–3–amino–3–(3–nitrophenyl)propanoic acid, Fmoc-(S)-3-amino-3-(3-nitrophenyl)propanoic acid, 97%, 97%, Fmoc-(S)-3-amino-3-(3-nitrophenyl)propanoic acid, 97%, Fmoc-L-β-Phe(3-NO2)-OH, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoic acid (CAS 374791-01-2) is a chemical compound with the molecular formula C24H20N2O6 and a molecular weight of 432.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoic acid. InChIKey: SFZOBIQWMMCMFE-QFIPXVFZSA-N.
| Molecular formula | C24H20N2O6 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoic acid |
| InChIKey | SFZOBIQWMMCMFE-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)O)C4=CC(=CC=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)