CAS 206060-42-6 appears in our catalog under these names: Fmoc-L-3-nitrophenylalanine, 97%, Fmoc–Phe(3–NO2)–OH, Fmoc-L-Phe(3-NO2)-OH, Fmoc-3-nitro-L-phenylalanine, Fmoc-L-Phe(3-NO2)-OH 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, Ambeed. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 2g, 100mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoic acid (CAS 206060-42-6) is a chemical compound with the molecular formula C24H20N2O6 and a molecular weight of 432.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoic acid. InChIKey: UDIZJKKIJYRJIN-QFIPXVFZSA-N.
| Molecular formula | C24H20N2O6 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-nitrophenyl)propanoic acid |
| InChIKey | UDIZJKKIJYRJIN-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=CC=C4)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)