CAS 210282-30-7 appears in our catalog under these names: Fmoc-L-2-nitrophenylalanine, 97%, Fmoc-L-2-nitrophenylalanine, >95% (HPLC), (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-nitrophenyl)propanoic acid, 97%, (9H–Fluoren–9–yl)MethOxy)Carbonyl L–2–Nitrophe, Fmoc-Phe(2-NO2)-OH 95%. Offered by: Combi-blocks, TRC, AmBeed, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 25g, 10g, 1g, 100mg, 250mg, 25mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitrophenyl)propanoic acid (CAS 210282-30-7) is a chemical compound with the molecular formula C24H20N2O6 and a molecular weight of 432.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitrophenyl)propanoic acid. InChIKey: KVLRWXBYPKSBFY-NRFANRHFSA-N.
| Molecular formula | C24H20N2O6 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitrophenyl)propanoic acid |
| InChIKey | KVLRWXBYPKSBFY-NRFANRHFSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)[N+](=O)[O-] |
Computed by PubChem (NCBI)