CAS 507472-25-5 appears in our catalog under these names: Fmoc–(S)–3–amino–3–(2–nitrophenyl)propionic acid, (S)-3-(Fmoc-amino)-3-(2-nitrophenyl)propionic acid, 95% , Fmoc-(S)-3-amino-3-(2-nitrophenyl)propionic acid, Fmoc-L-b-Phe(2-NO2)-OH 95%, Fmoc-(S)-3-Amino-3-(2-nitro-phenyl)-propionic acid, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 2000mg, 1000mg, 10g.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitrophenyl)propanoic acid (CAS 507472-25-5) is a chemical compound with the molecular formula C24H20N2O6 and a molecular weight of 432.4 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitrophenyl)propanoic acid. InChIKey: DRESTDPDCGPKNI-NRFANRHFSA-N.
| Molecular formula | C24H20N2O6 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-nitrophenyl)propanoic acid |
| InChIKey | DRESTDPDCGPKNI-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC(=O)O)C4=CC=CC=C4[N+](=O)[O-] |
Computed by PubChem (NCBI)