CAS 2170913-42-3 is the registry number for N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-(4-nitrobenzyl)glycine, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
2-[9H-fluoren-9-ylmethoxycarbonyl-[(4-nitrophenyl)methyl]amino]acetic acid (CAS 2170913-42-3) is a chemical compound with the molecular formula C24H20N2O6 and a molecular weight of 432.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl-[(4-nitrophenyl)methyl]amino]acetic acid. InChIKey: FOMPUKCWUFEMTH-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O6 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl-[(4-nitrophenyl)methyl]amino]acetic acid |
| InChIKey | FOMPUKCWUFEMTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N(CC4=CC=C(C=C4)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)