CAS 177966-63-1 appears in our catalog under these names: Fmoc-4-nitro-D-phenylalanine, 97%, Fmoc–D–Phe(4–NO2)–OH, Fmoc-D-Phe(4-NO2)-OH, Fmoc-D-Phe(4-NO2)-OH 97%, Fmoc-D-Phe(4-NO2)-OH, 97%, 97%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 500g, 250mg, 10g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-nitrophenyl)propanoic acid (CAS 177966-63-1) is a chemical compound with the molecular formula C24H20N2O6 and a molecular weight of 432.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-nitrophenyl)propanoic acid. InChIKey: RZRRJPNDKJOLHI-JOCHJYFZSA-N.
| Molecular formula | C24H20N2O6 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-nitrophenyl)propanoic acid |
| InChIKey | RZRRJPNDKJOLHI-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=C(C=C4)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)