cas: 159610-89-6 — see every product listed under this CAS number, including other names
Fmoc-Lys(N3)-OH 95% (CAS 159610-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A209622-100mg |
| cas | 159610-89-6 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 476.06 Pln | |
| Ambeed | 5g | 2105.88 Pln | |
| Ambeed | 10g | 4141.75 Pln | |
| Ambeed | 25g | 10243.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A209622 |
(2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 159610-89-6) is a chemical compound with the molecular formula C21H22N4O4 and a molecular weight of 394.4 g/mol. IUPAC name: (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: PJRFTUILPGJJIO-IBGZPJMESA-N.
| Molecular formula | C21H22N4O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | (2S)-6-azido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | PJRFTUILPGJJIO-IBGZPJMESA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)