cas: 139262-23-0 — see every product listed under this CAS number, including other names
Fmoc-Lys-OH.HCl, 98% (CAS 139262-23-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03421-1G |
| cas | 139262-23-0 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 50g | 346.77 Pln | |
| Fluorochem | 100g | 560.24 Pln | |
| Fluorochem | 250g | 1065.27 Pln | |
| Fluorochem | 500g | 1669.22 Pln | |
| Fluorochem | 1kg | 2611.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride (CAS 139262-23-0) is a chemical compound with the molecular formula C21H25ClN2O4 and a molecular weight of 404.9 g/mol. IUPAC name: (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride. InChIKey: MVMZFAIUUXYFGY-FYZYNONXSA-N.
| Molecular formula | C21H25ClN2O4 |
|---|---|
| Molecular weight | 404.9 g/mol |
| IUPAC name | (2S)-6-amino-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid;hydrochloride |
| InChIKey | MVMZFAIUUXYFGY-FYZYNONXSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN)C(=O)O.Cl |
Computed by PubChem (NCBI)