cas: 222725-35-1 — see every product listed under this CAS number, including other names
Fmoc-N-(allyl)-glycine, 98% (CAS 222725-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F494302-100MG |
| cas | 222725-35-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 232.23 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 5g | 2778.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-enyl)amino]acetic acid (CAS 222725-35-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-enyl)amino]acetic acid. InChIKey: NVNQGCMKCQZFSM-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-enyl)amino]acetic acid |
| InChIKey | NVNQGCMKCQZFSM-UHFFFAOYSA-N |
| SMILES | C=CCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)