cas: 174799-89-4 — see every product listed under this CAS number, including other names
Fmoc-N-(tert-butyloxycarbonylethyl)glycine, 98%, 98% (CAS 174799-89-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112ZXV-100mg |
| cas | 174799-89-4 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 1350.80 Pln | |
| Chemat | 10g | 2166.80 Pln | |
| Chemat | 25g | 3645.20 Pln | |
| Chemat | 50g | 5920.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[9H-fluoren-9-ylmethoxycarbonyl-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]acetic acid (CAS 174799-89-4) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 425.5 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]acetic acid. InChIKey: GSLFOWYOHAYGNA-UHFFFAOYSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]acetic acid |
| InChIKey | GSLFOWYOHAYGNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)