cas: 84000-07-7 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Ala-OH, 98%, 98% (CAS 84000-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145Y5-1g |
| cas | 84000-07-7 |
| size | 1g |
| availability | 952g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 50g | 261.20 Pln | |
| Chemat | 100g | 438.80 Pln | |
| Chemat | 250g | 957.20 Pln | |
| Chemat | 500g | 1785.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 84000-07-7) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: JOFHWKQIQLPZTC-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | JOFHWKQIQLPZTC-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)