CAS 1362858-88-5 appears in our catalog under these names: 2-([(9H-Fluoren-9-ylmethoxy)carbonyl](methyl)amino)propanoic acid, 98%, N–((9H–fluoren–9–ylmethoxy)carbonyl)–N–methylalanine, Fmoc-N-methyl-DL-alanine, Fmoc-N-Me-DL-Ala-OH 97%, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methylalanine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 2,5g, 100mg, 250mg, 5 g, 25 g.
2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid (CAS 1362858-88-5) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid. InChIKey: JOFHWKQIQLPZTC-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]propanoic acid |
| InChIKey | JOFHWKQIQLPZTC-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)