CAS 2260800-16-4 is the registry number for N-Fmoc-N-methyl-D-serine, ≥95%(210nm), ≥95%(210nm). Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxypropanoic acid (CAS 2260800-16-4) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxypropanoic acid. InChIKey: ZVWHTEOKMWNXGP-QGZVFWFLSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-hydroxypropanoic acid |
| InChIKey | ZVWHTEOKMWNXGP-QGZVFWFLSA-N |
| SMILES | CN([C@H](CO)C(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)