CAS 73731-37-0 appears in our catalog under these names: Fmoc-Thr-OH, 96%, Fmoc–Thr–OH, Fmoc-L-Thr-OH, Fmoc-Thr-OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-threonine Monohydrate, >98.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 100g, 25g, 500g, 5g, 250g, 0,25kg, 0,5kg, 1g.
(2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid (CAS 73731-37-0) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid. InChIKey: OYULCCKKLJPNPU-DIFFPNOSSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid |
| InChIKey | OYULCCKKLJPNPU-DIFFPNOSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)