CAS 157355-81-2 appears in our catalog under these names: Fmoc-D-Thr-OH, 97%, N–((9H–Fluoren–9–ylmethoxy)carbonyl)–D–threonine, Fmoc-D-Thr-OH, (2R,3S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-hydroxybutanoic acid, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-threonine, >98.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 5g, 100g, 25g, 1g, 2,5g, 0,25g, 10g, 50g.
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid (CAS 157355-81-2) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid. InChIKey: OYULCCKKLJPNPU-APPDUMDISA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid |
| InChIKey | OYULCCKKLJPNPU-APPDUMDISA-N |
| SMILES | C[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)