CAS 920287-51-0 is the registry number for (S)-4-(Methoxycarbonyl)-2-(4-biphenylcarboxylic amido)butanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
(2S)-5-methoxy-5-oxo-2-[(4-phenylbenzoyl)amino]pentanoic acid (CAS 920287-51-0) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2S)-5-methoxy-5-oxo-2-[(4-phenylbenzoyl)amino]pentanoic acid. InChIKey: UVWBPZKTWPDCPZ-INIZCTEOSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S)-5-methoxy-5-oxo-2-[(4-phenylbenzoyl)amino]pentanoic acid |
| InChIKey | UVWBPZKTWPDCPZ-INIZCTEOSA-N |
| SMILES | COC(=O)CC[C@@H](C(=O)O)NC(=O)C1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)