CAS 260367-12-2 appears in our catalog under these names: 2-(2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}ethoxy)acetic acid, 95%, 2-[2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]ethoxy]acetic acid, 98%, 98%, 5-(9-Fluorenylmethyloxycarbonyl-amino)-3-oxapentanoic acid, 96%, Fmoc–NH–PEG1–CH2COOH, Fmoc-O1Pen-OH. Offered by: Fluorochem, Chemat, Combi-blocks, GLPBio, Iris Biotech. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg, 50g, 100g.
2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]acetic acid (CAS 260367-12-2) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]acetic acid. InChIKey: LBVXPUINIMIGAU-UHFFFAOYSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]acetic acid |
| InChIKey | LBVXPUINIMIGAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOCC(=O)O |
Computed by PubChem (NCBI)