CAS 146306-75-4 appears in our catalog under these names: Fmoc-allo-Thr-OH, 98%, Fmoc–allo–Thr–OH, Fmoc-L-allo-Thr-OH, Fmoc-L-allo-threonine, 95%, 95%, (((9H-Fluoren-9-yl)methoxy)carbonyl)-L-allothreonine, 99.62%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg, 50g, 100g.
(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid (CAS 146306-75-4) is a chemical compound with the molecular formula C19H19NO5 and a molecular weight of 341.4 g/mol. IUPAC name: (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid. InChIKey: OYULCCKKLJPNPU-GTNSWQLSSA-N.
| Molecular formula | C19H19NO5 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | (2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxybutanoic acid |
| InChIKey | OYULCCKKLJPNPU-GTNSWQLSSA-N |
| SMILES | C[C@@H]([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)