cas: 77128-73-5 — see every product listed under this CAS number, including other names
Fmoc-N-Me-Phe-OH, 99.84% (CAS 77128-73-5) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 25 g, 100 g, 10mM/1mL, 1 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W010986-50 g |
| cas | 77128-73-5 |
| size | 50 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 909.48 Pln | |
| MedChemExpress | 25 g | 649.42 Pln | |
| MedChemExpress | 100 g | 1308.86 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 1 g | 240.74 Pln | |
| MedChemExpress | 5 g | 333.62 Pln | |
| MedChemExpress | 10 g | 421.86 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.84% |
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylpropanoic acid (CAS 77128-73-5) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylpropanoic acid. InChIKey: GBROUWPNYVBLFO-QHCPKHFHSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-phenylpropanoic acid |
| InChIKey | GBROUWPNYVBLFO-QHCPKHFHSA-N |
| SMILES | CN([C@@H](CC1=CC=CC=C1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)