cas: 1343040-07-2 — see every product listed under this CAS number, including other names
Fmoc-N-cPent-Gly-OH 98% (CAS 1343040-07-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A908282-100mg |
| cas | 1343040-07-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2428.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A908282 |
2-[cyclopentyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid (CAS 1343040-07-2) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 2-[cyclopentyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid. InChIKey: LVJZUYHCQLIJSA-UHFFFAOYSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 2-[cyclopentyl(9H-fluoren-9-ylmethoxycarbonyl)amino]acetic acid |
| InChIKey | LVJZUYHCQLIJSA-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N(CC(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)