cas: 201531-88-6 — see every product listed under this CAS number, including other names
Fmoc-Pen(Trt)-OH, 95% (CAS 201531-88-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F862169-100MG |
| cas | 201531-88-6 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 10g | 804.94 Pln | |
| Fluorochem | 25g | 1528.65 Pln | |
| Fluorochem | 50g | 2825.06 Pln | |
| Fluorochem | 100g | 5397.08 Pln | |
| Fluorochem | 250g | 11264.80 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid (CAS 201531-88-6) is a chemical compound with the molecular formula C39H35NO4S and a molecular weight of 613.8 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid. InChIKey: XSGMGAINOILNJR-PGUFJCEWSA-N.
| Molecular formula | C39H35NO4S |
|---|---|
| Molecular weight | 613.8 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methyl-3-tritylsulfanylbutanoic acid |
| InChIKey | XSGMGAINOILNJR-PGUFJCEWSA-N |
| SMILES | CC(C)([C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)SC(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)