cas: 148625-77-8 — see every product listed under this CAS number, including other names
Fmoc-Prolinol, 95% (CAS 148625-77-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M06279-1G |
| cas | 148625-77-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 195.78 Pln | |
| Fluorochem | 10g | 284.29 Pln | |
| Fluorochem | 25g | 502.97 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
9H-fluoren-9-ylmethyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 148625-77-8) is a chemical compound with the molecular formula C20H21NO3 and a molecular weight of 323.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: HJUXXCOVGMCKQL-AWEZNQCLSA-N.
| Molecular formula | C20H21NO3 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | HJUXXCOVGMCKQL-AWEZNQCLSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CO |
Computed by PubChem (NCBI)