cas: 150114-97-9 — see every product listed under this CAS number, including other names
Fmoc-Val-Ala-OH 97% (CAS 150114-97-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A597473-1g |
| cas | 150114-97-9 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 10g | 548.38 Pln | |
| Ambeed | 25g | 1032.31 Pln | |
| Ambeed | 100g | 2534.19 Pln | |
| Ambeed | 500g | 9937.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A597473 |
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid (CAS 150114-97-9) is a chemical compound with the molecular formula C23H26N2O5 and a molecular weight of 410.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid. InChIKey: KQZMZNLKVKGMJS-XOBRGWDASA-N.
| Molecular formula | C23H26N2O5 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid |
| InChIKey | KQZMZNLKVKGMJS-XOBRGWDASA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)