cas: 150114-97-9 — see every product listed under this CAS number, including other names
Fmoc-Val-Ala-OH, 99.85% (CAS 150114-97-9) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 1 g, 25 g, 50 g, 10 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W106311-5 g |
| cas | 150114-97-9 |
| size | 5 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 524.03 Pln | |
| MedChemExpress | 1 g | 319.69 Pln | |
| MedChemExpress | 25 g | 1322.80 Pln | |
| MedChemExpress | 50 g | 2042.62 Pln | |
| MedChemExpress | 10 g | 719.08 Pln | |
| MedChemExpress | 100 g | 3198.97 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.85% |
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid (CAS 150114-97-9) is a chemical compound with the molecular formula C23H26N2O5 and a molecular weight of 410.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid. InChIKey: KQZMZNLKVKGMJS-XOBRGWDASA-N.
| Molecular formula | C23H26N2O5 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoic acid |
| InChIKey | KQZMZNLKVKGMJS-XOBRGWDASA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)