cas: 112372-15-3 — see every product listed under this CAS number, including other names
Furo[2,3-c]pyridine-2-carboxylic acid, 97% (CAS 112372-15-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329705-100MG |
| cas | 112372-15-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 601.89 Pln | |
| Fluorochem | 250mg | 1049.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Furo[2,3-c]pyridine-2-carboxylic acid (CAS 112372-15-3) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: furo[2,3-c]pyridine-2-carboxylic acid. InChIKey: WMPIDXCJMDIDQY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | furo[2,3-c]pyridine-2-carboxylic acid |
| InChIKey | WMPIDXCJMDIDQY-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1C=C(O2)C(=O)O |
Computed by PubChem (NCBI)