cas: 122535-04-0 — see every product listed under this CAS number, including other names
Furo[3,2-b]pyridine-6-carboxylic acid, 97% (CAS 122535-04-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689933-100MG |
| cas | 122535-04-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 1g | 1695.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Furo[3,2-b]pyridine-6-carboxylic acid (CAS 122535-04-0) is a chemical compound with the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. IUPAC name: furo[3,2-b]pyridine-6-carboxylic acid. InChIKey: LIYSYIKDUZFTJS-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | furo[3,2-b]pyridine-6-carboxylic acid |
| InChIKey | LIYSYIKDUZFTJS-UHFFFAOYSA-N |
| SMILES | C1=COC2=C1N=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)