CAS 66318-17-0 appears in our catalog under these names: Furprofen/ 99.32% (existing batch purity), Furprofen, Furprofen, 98.90%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
2-[4-(furan-2-carbonyl)phenyl]propanoic acid (CAS 66318-17-0) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 2-[4-(furan-2-carbonyl)phenyl]propanoic acid. InChIKey: ITJUVDBADHDNPU-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 2-[4-(furan-2-carbonyl)phenyl]propanoic acid |
| InChIKey | ITJUVDBADHDNPU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)C2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)