CAS 112811-66-2 appears in our catalog under these names: Moxifloxacin Impurity 59, 2,4,5–Trifluoro–3–methoxybenzoyl chloride, 2,4,5-Trifluoro-3-methoxybenzoyl chloride, 95% , 2,4,5-Trifluoro-3-methoxybenzoyl chloride, 97%. Offered by: Chemat Brand, GLPBio, Thermo Scientific, Fluorochem. Available pack sizes: on request, 1g, 25g, 5g, 10g.
2,4,5-trifluoro-3-methoxybenzoyl chloride (CAS 112811-66-2) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzoyl chloride. InChIKey: JVQSZTJTWSUJCR-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzoyl chloride |
| InChIKey | JVQSZTJTWSUJCR-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C(=O)Cl)F |
Computed by PubChem (NCBI)