CAS 870614-04-3 is the registry number for 1-(5-Chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone (CAS 870614-04-3) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone. InChIKey: ZIEZOWUWNOVSDH-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 1-(5-chloro-2-hydroxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | ZIEZOWUWNOVSDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)