CAS 1737-36-6 appears in our catalog under these names: 4-Chloro-3-(Trifluoromethyl)benzoic Acid, 4–Chloro–3–(trifluoromethyl)benzoic acid, 4-Chloro-3-(trifluoromethyl)benzoic Acid, >98.0%(GC)(T), 4-Chloro-3-(trifluoromethyl)benzoic acid, 98%, 98%, 4-Chloro-3-(trifluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: on request, 100g, 25g, 1g, 5g, 10g, 250g, 50g.
4-chloro-3-(trifluoromethyl)benzoic acid (CAS 1737-36-6) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 4-chloro-3-(trifluoromethyl)benzoic acid. InChIKey: PPHHAZOVVZBSCM-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 4-chloro-3-(trifluoromethyl)benzoic acid |
| InChIKey | PPHHAZOVVZBSCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)