Products 1261677-92-2
CAS 1261677-92-2 is the registry number for 2-(Difluoromethoxy)-6-fluorobenzoyl chloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethoxy)-6-fluorobenzoyl chloride (CAS 1261677-92-2) is a chemical compound with the molecular formula C8H4ClF3O2 and a molecular weight of 224.56 g/mol. IUPAC name: 2-(difluoromethoxy)-6-fluorobenzoyl chloride. InChIKey: DUINTBJDHPEISI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O2 |
|---|---|
| Molecular weight | 224.56 g/mol |
| IUPAC name | 2-(difluoromethoxy)-6-fluorobenzoyl chloride |
| InChIKey | DUINTBJDHPEISI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)Cl)OC(F)F |
Computed by PubChem (NCBI)